| Compound ID | 2097 |
| Compound Structure | |
| Plant Source | Macropiper excelsum Common Name:Kawakawa |
| Source Family | Piperaceae |
| Origin | New Zealand |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | 96 well - plate format assay for bacteriostatic activity, two - fold serial dilution to measure any background optical density or fluorescence associated with the extract |
| Positive Control Used (conc.) | Rifampin (100 µM), Streptomycin (100 µM) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Rheumatism, arthritis, diuretic, bruises and chest difficulties |
| PubMed ID [Source Literature] | 20537175 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Earl EA, Altaf M, Murikoli RV, Swift S, O Toole R.Native New Zealand plants with inhibitory activity towards Mycobacterium tuberculosis.BMC Complement Altern Med. 2010 Jun 10;10:25
|
| Curator | |
| Compound ID | 2311 |
| Compound Structure | |
| Plant Source | Peperomia alata R.& P. Common Name: |
| Source Family | Piperaceae |
| Origin | Peru |
| Plant Part Used | Whole plant |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml ) and Ethambutol (7.5 µg/ml) |
| Inhibition [%] | 60 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 2351 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Safrol |
| PubChem ID | 5144 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.068 |
| Molecular Formula | C10H10O2
|
| SMILES | O1c2c(OC1)ccc(c2)CC=C |
| XLogP | 2.930 |
| PSA | 18.460 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2352 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Methyl eugenol |
| PubChem ID | 7127 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 178.099 |
| Molecular Formula | C11H14O2
|
| SMILES | O(c1cc(CC=C)ccc1OC)C |
| XLogP | 3.003 |
| PSA | 18.460 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2353 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Terpinolene |
| PubChem ID | 11463 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1C(=C(C)C)CC=C(C1)C |
| XLogP | 3.326 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2354 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | γ - Terpinene |
| PubChem ID | 7461 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C(C1=CCC(=CC1)C)(C)C |
| XLogP | 3.852 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2355 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | P - Cymene (0.2 %) |
| PubChem ID | 7463 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Alkyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 134.110 |
| Molecular Formula | C10H14
|
| SMILES | C(c1ccc(cc1)C)(C)C |
| XLogP | 5.785 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2356 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - β - Caryophyllene |
| PubChem ID | 5281515 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24
|
| SMILES | C1([C@H]2[C@H](C1)C(=C)CC/C=C(/CC2)C)(C)C |
| XLogP | 6.044 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2357 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Eugenol |
| PubChem ID | 3314 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 164.084 |
| Molecular Formula | C10H12O2
|
| SMILES | O(c1cc(CC=C)ccc1O)C |
| XLogP | 2.484 |
| PSA | 29.460 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2358 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Elemicin |
| PubChem ID | 10248 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 208.110 |
| Molecular Formula | C12H16O3
|
| SMILES | O(c1c(OC)cc(CC=C)cc1OC)C |
| XLogP | 2.559 |
| PSA | 27.690 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2359 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Spathulenol |
| PubChem ID | 522266 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 220.183 |
| Molecular Formula | C15H24O
|
| SMILES | OC1(C2C3C(C3CCC(=C)C2CC1)(C)C)C |
| XLogP | 4.157 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2360 |
| Compound Structure | |
| Plant Source | Piper betle L. Common Name:Betel, Betel Pepper, Betelvine, Betel Vine (English), Naagavall, Parna, Tambula (Sanskrit) |
| Source Family | Piperaceae |
| Origin | India, Malaysia |
| Plant Part Used | Leaf |
| Extract | Essential oil |
| Target Bacteria | Mycobacterium tuberculosis B19 - 3 (human) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:5000 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, bronchitis, asthma, respiratory catarrh, diptheria, bronchitis, phthisis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta, K.C., Viswanathan, R., 1956. Antitubercular substances from plants. A preliminary study. Antibiotics and Chemotherapy 6, 194195
2) http://www.plantnames.unimelb.edu.au/Sorting/Piper.html
3) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 14. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2361 |
| Compound Structure | |
| Plant Source | Piper betle L. Common Name:Betel, Betel Pepper, Betelvine, Betel Vine (English), Naagavall, Parna, Tambula (Sanskrit) |
| Source Family | Piperaceae |
| Origin | India, Malaysia |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, bronchitis, asthma, respiratory catarrh, diptheria, bronchitis, phthisis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Ahmad, Fasihuddin B. and Ghazally Ismail.Medicinal plants used by Kadazandusun communities around Crocker Range.Published in: ASEAN Review of Biodiversity and Environmental Conservation, January-March issue (10 p.), 2003 (Available at: http://www.arbec.com.my/pdf/art1janmar03.pdf)
2) http://www.plantnames.unimelb.edu.au/Sorting/Piper.html
3) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 14. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2362 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sesquisabinene hydrate |
| PubChem ID | 6428435 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene, Alcohol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O
|
| SMILES | O[C@]1(C2[C@](C2)(CC1)C(CCC=C(C)C)C)C |
| XLogP | 4.683 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2363 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Phellandrene |
| PubChem ID | 7460 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(C(C)C)CC=C(C=C1)C |
| XLogP | 4.427 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2364 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Pinene (8.7 %) |
| PubChem ID | 6654 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(C2CC1C(=CC2)C)(C)C |
| XLogP | 4.177 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2365 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Limonene (5.3 %) |
| PubChem ID | 22311 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(CCC(=CC1)C)C(=C)C |
| XLogP | 3.729 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2366 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linalool (4.7 %) |
| PubChem ID | 6549 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Monoterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 154.136 |
| Molecular Formula | C10H18O
|
| SMILES | OC(CCC=C(C)C)(C)C=C |
| XLogP | 2.468 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2367 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | P - Cymene (4.4 %) |
| PubChem ID | 7463 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Alkyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 134.110 |
| Molecular Formula | C10H14
|
| SMILES | C(c1ccc(cc1)C)(C)C |
| XLogP | 5.785 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2368 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | β - Phellandrene |
| PubChem ID | 11142 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(C(C)C)CCC(=C)C=C1 |
| XLogP | 4.472 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2369 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | δ - Cadinene |
| PubChem ID | 441005 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24
|
| SMILES | [C@@H]1([C@H]2C(=C(CC1)C)CCC(=C2)C)C(C)C |
| XLogP | 5.460 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2370 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Bisabolol |
| PubChem ID | 10586 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene, Prenylated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O
|
| SMILES | OC(C1CCC(=CC1)C)(CCC=C(C)C)C |
| XLogP | 4.085 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2371 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - β - Caryophyllene (3.1 %) |
| PubChem ID | 5281515 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24
|
| SMILES | C1([C@H]2[C@H](C1)C(=C)CC/C=C(/CC2)C)(C)C |
| XLogP | 6.044 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2372 |
| Compound Structure | |
| Plant Source | Piper capense L.f Common Name:Wild Pepper |
| Source Family | Piperaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (2.00 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Used for cough, bronchial problems, leprosy and infertility |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
2) http://www.zimbabweflora.co.zw/speciesdata/species.php?species_id=119880
|
| Curator | |
| Compound ID | 2373 |
| Compound Structure | |
| Plant Source | Piper capense L.f Common Name:Wild Pepper |
| Source Family | Piperaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis 2 (Clinical isolates resistant to Streptomycin, Rifampin, Ethambutol, Isoniazid) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (100 µg/ml), Isoniazid (4.6 µg/ml), Ethambutol (12 µg/ml), Streptomycin (120 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Used for cough, bronchial problems, leprosy and infertility |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
2) http://www.zimbabweflora.co.zw/speciesdata/species.php?species_id=119880
|
| Curator | |