| Compound ID | 2430 |
| Compound Structure |  |
| Plant Source | Potamogeton malaianus Common Name:Curly Pondweed (English) |
| Source Family | Potamogetonaceae |
| Origin | India |
| Plant Part Used | |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Potamogetonyde |
| PubChem ID | 485584 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 11277765 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Diterpene, Terpene, Furanoid, Acetyl, Alcohol, Aldehyde |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 358.214 |
| Molecular Formula | C22H30O4
|
| SMILES | O(C[C@]1([C@@H]2[C@]([C@@H](C(=C)CC2)CCc2ccoc2)(CCC1)C=O)C)C(=O)C |
| XLogP | 4.517 |
| PSA | 56.510 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Kittakoop P, Wanasith S, Watts P, Kramyu J, Tanticharoen M, Thebtaranonth Y.Potent antiviral potamogetonyde and potamogetonol, new furanoid labdane diterpenes from Potamogeton malaianus.J Nat Prod. 2001 Mar;64(3):385-8
|
| Curator | |
| Compound ID | 2431 |
| Compound Structure |  |
| Plant Source | Potamogeton malaianus Common Name:Curly Pondweed (English) |
| Source Family | Potamogetonaceae |
| Origin | India |
| Plant Part Used | |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Potamogetonol |
| PubChem ID | 485585 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 11277765 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Diterpene, Terpene, Furanoid, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 360.230 |
| Molecular Formula | C22H32O4
|
| SMILES | OC[C@]12[C@@H]([C@@](CCC1)(COC(=O)C)C)CCC(=C)[C@H]2CCc1ccoc1 |
| XLogP | 4.410 |
| PSA | 59.670 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Kittakoop P, Wanasith S, Watts P, Kramyu J, Tanticharoen M, Thebtaranonth Y.Potent antiviral potamogetonyde and potamogetonol, new furanoid labdane diterpenes from Potamogeton malaianus.J Nat Prod. 2001 Mar;64(3):385-8
|
| Curator | |
| Compound ID | 2432 |
| Compound Structure |  |
| Plant Source | Potamogeton malaianus Common Name:Curly Pondweed (English) |
| Source Family | Potamogetonaceae |
| Origin | India |
| Plant Part Used | |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Potamogetonin |
| PubChem ID | 6453492 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 11277765 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Furanoid, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 314.188 |
| Molecular Formula | C20H26O3 |
| SMILES | CC12CCCC3(C1CCC(=C)C3CCC4=COC=C4)C(=O)OC2 |
| XLogP | 4.183 |
| PSA | 39.440 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Kittakoop P, Wanasith S, Watts P, Kramyu J, Tanticharoen M, Thebtaranonth Y.Potent antiviral potamogetonyde and potamogetonol, new furanoid labdane diterpenes from Potamogeton malaianus.J Nat Prod. 2001 Mar;64(3):385-8
|
| Curator | |
| Compound ID | 2433 |
| Compound Structure |  |
| Plant Source | Potamogeton malaianus Common Name:Curly Pondweed (English) |
| Source Family | Potamogetonaceae |
| Origin | India |
| Plant Part Used | |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 15,16-epoxy-12-oxo-8(17),13(16),14-labdatrien-20,19-olide |
| PubChem ID | 5478978 |
| Ethnomedicinal Information | Anti-inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 11277765 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Diterpene, Terpene, Furanoid, Lactone, Ketone, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 328.167 |
| Molecular Formula | C20H24O4
|
| SMILES | O1C[C@]2([C@@H]3[C@]([C@@H](C(=C)CC3)CC(=O)c3ccoc3)(CCC2)C1=O)C |
| XLogP | 2.899 |
| PSA | 56.510 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Kittakoop P, Wanasith S, Watts P, Kramyu J, Tanticharoen M, Thebtaranonth Y.Potent antiviral potamogetonyde and potamogetonol, new furanoid labdane diterpenes from Potamogeton malaianus.J Nat Prod. 2001 Mar;64(3):385-8
|
| Curator | |
| Compound ID | 2434 |
| Compound Structure | |
| Plant Source | Potamogeton natans L. Common Name: |
| Source Family | Potamogetonaceae |
| Origin | India |
| Plant Part Used | Aerial |
| Extract | Ethanol (80 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | Partial |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cold, fever, blood diseases, used in herbal medicine for other diseases |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Al-Shamma A, Mitscher LA.Comprehensive survey of indigenous Iraqi plants for potential economic value. 1. Screening results of 327 species for alkaloids and antimicrobial agents.J Nat Prod. 1979 Nov-Dec;42(6):633-42
2) Sharma, S.K., 1998. Medicinal Plants Used in Ayurveda. National Academy of Ayurveda, Ministry of Health and Family Welfare, Govt. of India, New Delhi, India
|
| Curator | |
| Compound ID | 2435 |
| Compound Structure | |
| Plant Source | Potamogeton pectinatus L. Common Name: |
| Source Family | Potamogetonaceae |
| Origin | India |
| Plant Part Used | Aerial, seed |
| Extract | Ethanol (80 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | Partial |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cold, fever, blood diseases, used in herbal medicine for other diseases |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Al-Shamma A, Mitscher LA.Comprehensive survey of indigenous Iraqi plants for potential economic value. 1. Screening results of 327 species for alkaloids and antimicrobial agents.J Nat Prod. 1979 Nov-Dec;42(6):633-42
2) Sharma, S.K., 1998. Medicinal Plants Used in Ayurveda. National Academy of Ayurveda, Ministry of Health and Family Welfare, Govt. of India, New Delhi, India
|
| Curator | |