| Compound ID | 1251 |
| Compound Structure | |
| Plant Source | Berchemia discolor (Klotzsch) Hemsl. Common Name:Bird - Plum, Brown Ivory |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Infertility and Menorrhagia |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1252 |
| Compound Structure | |
| Plant Source | Berchemia discolor (Klotzsch) Hemsl. Common Name:Bird - Plum, Brown Ivory |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Infertility and Menorrhagia |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1253 |
| Compound Structure | |
| Plant Source | Berchemia discolor (Klotzsch) Hemsl. Common Name:Bird - Plum, Brown Ivory |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis 2 (Clinical isolates resistant to Streptomycin, Rifampin, Ethambutol, Isoniazid) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (100 µg/ml), Isoniazid (4.6 µg/ml), Ethambutol (12 µg/ml), Streptomycin (120 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Infertility and Menorrhagia |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1254 |
| Compound Structure | |
| Plant Source | Berchemia discolor (Klotzsch) Hemsl. Common Name:Bird - Plum, Brown Ivory |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis 2 (Clinical isolates resistant to Streptomycin, Rifampin, Ethambutol, Isoniazid) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (100 µg/ml), Isoniazid (4.6 µg/ml), Ethambutol (12 µg/ml), Streptomycin (120 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Infertility and Menorrhagia |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1824 |
| Compound Structure | |
| Plant Source | Gouania lupuloides (L.) Urb. Common Name: |
| Source Family | Rhamnaceae |
| Origin | Peru |
| Plant Part Used | Stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | < 50 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 1974 |
| Compound Structure |  |
| Plant Source | Karwinskia humboldtiana Common Name:Wild Cherry |
| Source Family | Rhamnaceae |
| Origin | USA |
| Plant Part Used | Root |
| Extract | Dichloromethane, ethanol (95 %) |
| Target Bacteria | Mycobacterium smegmatis (ATCC 607) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Karwinaphthol B |
| PubChem ID | 442522 |
| Ethnomedicinal Information | Seeds are poisonous but fruit pulp is edible. Used locally in Mexico to treat convulsions |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Isochroman, Benzopyran, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 288.136 |
| Molecular Formula | C17H20O4
|
| SMILES | O1[C@@H](c2c(C[C@@H]1C)cc1c(c2O)c(OC)cc(OC)c1)C |
| XLogP | 2.444 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Gollapudi SR, Oburn DS, Drake S. 1985. Antimicrobial agents from higher plants: Two dimethylbenzisochromans from Karawinskia humboldtiana. Phytochemistry 24: 1681±1683.
2) Usher G. 1974. A Dictionary of Plants Used by Man. Macmillan: New York; 82
|
| Curator | |
| Compound ID | 2845 |
| Compound Structure | |
| Plant Source | Ziziphus mauritiana Lam. syn. Ziziphus jujuba Lam. Common Name:Indian Jujube (English), Badar, Kola (Sanskrit) |
| Source Family | Rhamnaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Chloramphenicol |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000000 µg/ml of dried plant |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, asthma |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Taylor RS, Manandhar NP, Towers GH.Screening of selected medicinal plants of Nepal for antimicrobial activities.J Ethnopharmacol. 1995 Jun;46(3):153-9
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2846 |
| Compound Structure | |
| Plant Source | Ziziphus mucronata Willd. Common Name:Buffalo Thorn, Cape Thorn |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (2.00 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Boils, sores, glandular swellings, diarrhoea, dysentery, expectorant, emetic for coughs, chest problems, boils, sores, glandular swellings |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
2) http://www.worldagroforestrycentre.org/sea/Products/AFDbases/af/asp/SpeciesInfo.asp?SpID=1725
|
| Curator | |
| Compound ID | 2847 |
| Compound Structure | |
| Plant Source | Ziziphus mucronata Willd. Common Name:Buffalo Thorn, Cape Thorn |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis 2 (Clinical isolates resistant to Streptomycin, Rifampin, Ethambutol, Isoniazid) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (100 µg/ml), Isoniazid (4.6 µg/ml), Ethambutol (12 µg/ml), Streptomycin (120 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Boils, sores, glandular swellings, diarrhoea, dysentery, expectorant, emetic for coughs, chest problems |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
2) http://www.worldagroforestrycentre.org/sea/Products/AFDbases/af/asp/SpeciesInfo.asp?SpID=1725
|
| Curator | |
| Compound ID | 2848 |
| Compound Structure | |
| Plant Source | Ziziphus mucronata Willd. Common Name:Buffalo Thorn, Cape Thorn |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant), Mycobacterium tuberculosis (Isoniazid resistant), Mycobacterium tuberculosis (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Boils, sores, glandular swellings, diarrhoea, dysentery, expectorant, emetic for coughs, chest problems |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
2) http://www.worldagroforestrycentre.org/sea/Products/AFDbases/af/asp/SpeciesInfo.asp?SpID=1725
|
| Curator | |
| Compound ID | 3553 |
| Compound Structure |  |
| Plant Source | Colubrina retusa (Ditter) Common Name: |
| Source Family | Rhamnaceae |
| Origin | Venezuela |
| Plant Part Used | Stem |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare (ATCC 23068) |
| Assay / Test Done | OADC - Supplemented Middlebrook Broth |
| Positive Control Used (conc.) | Rifampin (0.3 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Jujubogenin 3 - O - α - L - Arabinofuranosyl (1-->2) - [3 - O - (Trans) - P - Coumaroyl - β - D - Glucopyranosyl (1-->3)] - α - L - Arabinopyranoside |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10514332 |
| Extract Preparation | Air dried stem were powdered, extracted at 37°C in ethanol, suspended in water and then again extracted with chloroform and then with butanol and finally evaporated to dryness to yield the compound |
| Chemical Classification [Active Compound] | Alicyclic, Polycyclic, Steroid, Pyran, Cinnamate, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 1044.529 |
| Molecular Formula | C55H80O19 |
| SMILES | C1C[C@@H](C(C2[C@]1(C1[C@@](CC2)(C23C(CC1)C1C(C2)(OC(C[C@@]1(O)C)C=C(C)C)OC3)C)C)(C)C)OC1OC[C@@H]([C@@H]([C@@H]1OC1O[C@@H]([C@@H]([C@@H]1O)O)CO)O[C@@H]1OC([C@@H]([C@@H](C1O)OC(=O)/C=C/c1ccc(cc1)O)O)CO)O |
| XLogP | 5.255 |
| PSA | 282.210 |
| H-bond Donor | 9 |
| H-bond Acceptor | 19 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 10 |
| No. of N | 0 |
| No. of O | 19 |
| No. of S | 0 |
| Reference(s) | 1) ElSohly HN, Danner S, Li XC, Nimrod AC, Clark AM.New antimycobacterial saponin from Colubrina retusa.J Nat Prod. 1999 Sep;62(9):1341-2
|
| Curator | Farzana-shamsudeen, vikramjitmandal |
| Compound ID | 3744 |
| Compound Structure |  |
| Plant Source | Ziziphus cambodiana Pierre Common Name:NR |
| Source Family | Rhamnaceae |
| Origin | Northeast of Thailand |
| Plant Part Used | Root bark |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | >= 90 % |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 3-O-Vanillylceanothic acid |
| PubChem ID | 11988338 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16595959 |
| Extract Preparation | Pulverized, dry root bark (4.85 kg) of Ziziphus cambodiana was defatted with hexane and then extracted successively with ethyl acetate (EtOAc) and Methanol (MeOH) at 50°C for 50 h, and the solvents were evaporated to yield EtOAc (60.4 g) and MeOH (629.3 g) extracts, respectively |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Vanillyl, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 636.366 |
| Molecular Formula | C38H52O8 |
| SMILES | O([C@@H]1C([C@H]2[C@@](C3[C@]([C@]4(C(C5[C@@](CC4)(CC[C@H]5C(=C)C)C(=O)O)CC3)C)(CC2)C)([C@H]1C(=O)O)C)(C)C)C(=O)c1cc(OC)c(O)cc1 |
| XLogP | 9.336 |
| PSA | 130.360 |
| H-bond Donor | 3 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Panseeta P, Kunchanawatta S, Distaporn T, Ruktasing S, Suksamrarn A.Ceanothane- and lupane-type triterpenes with antiplasmodial and antimycobacterial activities from Ziziphus cambodiana.Chem Pharm Bull (Tokyo). 2006 Apr;54(4):535-7
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3745 |
| Compound Structure |  |
| Plant Source | Ziziphus cambodiana Pierre Common Name:NR |
| Source Family | Rhamnaceae |
| Origin | Northeast of Thailand |
| Plant Part Used | Root bark |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | >= 90 % |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Betulinaldehyde |
| PubChem ID | 317607 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16595959 |
| Extract Preparation | Pulverized, dry root bark (4.85 kg) of Ziziphus cambodiana was defatted with hexane and then extracted successively with ethyl acetate (EtOAc) and Methanol (MeOH) at 50°C for 50 h, and the solvents were evaporated to yield EtOAc (60.4 g) and MeOH (629.3 g) extracts, respectively |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Aldehyde, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 440.365 |
| Molecular Formula | C30H48O2 |
| SMILES | OC1C(C2C(C3C(C4(C(C5C(CC4)(CCC5C(=C)C)C=O)CC3)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.821 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Panseeta P, Kunchanawatta S, Distaporn T, Ruktasing S, Suksamrarn A.Ceanothane- and lupane-type triterpenes with antiplasmodial and antimycobacterial activities from Ziziphus cambodiana.Chem Pharm Bull (Tokyo). 2006 Apr;54(4):535-7
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3746 |
| Compound Structure |  |
| Plant Source | Ziziphus cambodiana Pierre Common Name:NR |
| Source Family | Rhamnaceae |
| Origin | Northeast of Thailand |
| Plant Part Used | Root bark |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | >= 90 % |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Betulinic acid |
| PubChem ID | 64971 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16595959 |
| Extract Preparation | Pulverized, dry root bark (4.85 kg) of Ziziphus cambodiana was defatted with hexane and then extracted successively with ethyl acetate (EtOAc) and Methanol (MeOH) at 50°C for 50 h, and the solvents were evaporated to yield EtOAc (60.4 g) and MeOH (629.3 g) extracts, respectively |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3 |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4([C@@H]([C@@H]5[C@@](CC4)(CC[C@H]5C(=C)C)C(=O)O)CC3)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.407 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Panseeta P, Kunchanawatta S, Distaporn T, Ruktasing S, Suksamrarn A.Ceanothane- and lupane-type triterpenes with antiplasmodial and antimycobacterial activities from Ziziphus cambodiana.Chem Pharm Bull (Tokyo). 2006 Apr;54(4):535-7
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3747 |
| Compound Structure |  |
| Plant Source | Ziziphus cambodiana Pierre Common Name:NR |
| Source Family | Rhamnaceae |
| Origin | Northeast of Thailand |
| Plant Part Used | Root bark |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | >= 90 % |
| Activity [MIC] µg/ml | 12.5 µg/ml (IC50 : 0.9) |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2-O-E-p-Coumaroylalphitolic |
| PubChem ID | 15958446 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16595959 |
| Extract Preparation | Pulverized, dry root bark (4.85 kg) of Ziziphus cambodiana was defatted with hexane and then extracted successively with ethyl acetate (EtOAc) and Methanol (MeOH) at 50°C for 50 h, and the solvents were evaporated to yield EtOAc (60.4 g) and MeOH (629.3 g) extracts, respectively |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol, Acid, Cinnamoyl, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 618.392 |
| Molecular Formula | C39H54O6 |
| SMILES | O([C@@H]1C[C@@]2(C3[C@]([C@]4(C(C5[C@@](CC4)(CC[C@H]5C(=C)C)C(=O)O)CC3)C)(CC[C@H]2C([C@H]1O)(C)C)C)C)C(=O)/C=C/c1ccc(O)cc1 |
| XLogP | 10.872 |
| PSA | 104.060 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Panseeta P, Kunchanawatta S, Distaporn T, Ruktasing S, Suksamrarn A.Ceanothane- and lupane-type triterpenes with antiplasmodial and antimycobacterial activities from Ziziphus cambodiana.Chem Pharm Bull (Tokyo). 2006 Apr;54(4):535-7
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3748 |
| Compound Structure |  |
| Plant Source | Ziziphus cambodiana Pierre Common Name:NR |
| Source Family | Rhamnaceae |
| Origin | Northeast of Thailand |
| Plant Part Used | Root bark |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | >= 90 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Alphitolic acid |
| PubChem ID | 470606 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16595959 |
| Extract Preparation | Pulverized, dry root bark (4.85 kg) of Ziziphus cambodiana was defatted with hexane and then extracted successively with ethyl acetate (EtOAc) and Methanol (MeOH) at 50°C for 50 h, and the solvents were evaporated to yield EtOAc (60.4 g) and MeOH (629.3 g) extracts, respectively |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 470.340 |
| Molecular Formula | C30H46O4 |
| SMILES | O[C@@H]1C(C2[C@@](C3[C@]([C@]4(C(=CC3)C3[C@@](CC4)(CC[C@H]3C(=C)C)C(=O)O)C)(CC2)C)(C[C@H]1O)C)(C)C |
| XLogP | 7.326 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Panseeta P, Kunchanawatta S, Distaporn T, Ruktasing S, Suksamrarn A.Ceanothane- and lupane-type triterpenes with antiplasmodial and antimycobacterial activities from Ziziphus cambodiana.Chem Pharm Bull (Tokyo). 2006 Apr;54(4):535-7
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3749 |
| Compound Structure |  |
| Plant Source | Ziziphus cambodiana Pierre Common Name:NR |
| Source Family | Rhamnaceae |
| Origin | Northeast of Thailand |
| Plant Part Used | Root bark |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | >= 90 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Zizyberanalic acid |
| PubChem ID | 15958447 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16595959 |
| Extract Preparation | Pulverized, dry root bark (4.85 kg) of Ziziphus cambodiana was defatted with hexane and then extracted successively with ethyl acetate (EtOAc) and Methanol (MeOH) at 50°C for 50 h, and the solvents were evaporated to yield EtOAc (60.4 g) and MeOH (629.3 g) extracts, respectively |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol, Aldehyde, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 470.340 |
| Molecular Formula | C30H46O4 |
| SMILES | O[C@H]1C([C@H]2[C@@](C3[C@]([C@]4(C(C5[C@@](CC4)(CC[C@H]5C(=C)C)C(=O)O)CC3)C)(CC2)C)([C@@H]1C=O)C)(C)C |
| XLogP | 8.733 |
| PSA | 74.600 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Panseeta P, Kunchanawatta S, Distaporn T, Ruktasing S, Suksamrarn A.Ceanothane- and lupane-type triterpenes with antiplasmodial and antimycobacterial activities from Ziziphus cambodiana.Chem Pharm Bull (Tokyo). 2006 Apr;54(4):535-7
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3750 |
| Compound Structure |  |
| Plant Source | Ziziphus cambodiana Pierre Common Name:NR |
| Source Family | Rhamnaceae |
| Origin | Northeast of Thailand |
| Plant Part Used | Root bark |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | >= 90 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Zizyberenalic acid |
| PubChem ID | 15958447 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16595959 |
| Extract Preparation | Pulverized, dry root bark (4.85 kg) of Ziziphus cambodiana was defatted with hexane and then extracted successively with ethyl acetate (EtOAc) and Methanol (MeOH) at 50°C for 50 h, and the solvents were evaporated to yield EtOAc (60.4 g) and MeOH (629.3 g) extracts, respectively |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol, Aldehyde, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 470.340 |
| Molecular Formula | C30H46O4 |
| SMILES | O[C@H]1C([C@H]2[C@@](C3[C@]([C@]4(C(C5[C@@](CC4)(CC[C@H]5C(=C)C)C(=O)O)CC3)C)(CC2)C)([C@@H]1C=O)C)(C)C |
| XLogP | 8.733 |
| PSA | 74.600 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Panseeta P, Kunchanawatta S, Distaporn T, Ruktasing S, Suksamrarn A.Ceanothane- and lupane-type triterpenes with antiplasmodial and antimycobacterial activities from Ziziphus cambodiana.Chem Pharm Bull (Tokyo). 2006 Apr;54(4):535-7
|
| Curator | Vikramjitmandal, rachanake |