| Compound ID | 1461 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1462 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1463 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Isoniazid resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1464 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1465 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1466 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Chloroform, methanol, water |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1467 |
| Compound Structure | |
| Plant Source | Citrus microcarpa Bunge Common Name:Musk Lime (English) |
| Source Family | Rutaceae |
| Origin | Malaysia |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1600 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Anonymous, 2010e. Khasiat limau kasturi (Available at: http://petuasejagat.blogspot.in/2010/01/5-khasiat-limau-kasturi.html)
|
| Curator | |
| Compound ID | 1468 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1469 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1470 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Isoniazid resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1471 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1472 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1473 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Chloroform, methanol, water |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1474 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Dentatin |
| PubChem ID | 342801 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Benzopyran, Alkene, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1c2c(C(C)(C)C=C)c3oc(=O)ccc3c(OC)c2C=CC1(C)C |
| XLogP | 4.812 |
| PSA | 35.530 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1475 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Nor - Dentatin |
| PubChem ID | 5495613 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Benzopyran, Alkene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 312.136 |
| Molecular Formula | C19H20O4
|
| SMILES | O1c2c(C(C)(C)C=C)c3oc(=O)ccc3c(O)c2C=CC1(C)C |
| XLogP | 4.293 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1476 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Clausenidin |
| PubChem ID | 5315947 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Chromone, Alkene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 328.131 |
| Molecular Formula | C19H20O5
|
| SMILES | O1C(CC(=O)c2c1c(C(C)(C)C=C)c1oc(=O)ccc1c2O)(C)C |
| XLogP | 3.411 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1477 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3 - Formylcarbazole |
| PubChem ID | 20746 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Carbazole, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 181.089 |
| Molecular Formula | C13H11N
|
| SMILES | [nH]1c2c(c3c1cccc3)cc(cc2)C |
| XLogP | 4.401 |
| PSA | 15.790 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1478 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mukonal |
| PubChem ID | 504068 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Aldehyde, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 211.063 |
| Molecular Formula | C13H9NO2
|
| SMILES | Oc1cc2[nH]c3c(c2cc1C=O)cccc3 |
| XLogP | 2.984 |
| PSA | 53.090 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1479 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3 - Methoxycarbonylcarbazole |
| PubChem ID | NR |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Carbazole, Ester |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 225.079 |
| Molecular Formula | C14H11NO2 |
| SMILES | [nH]1c2c(c3c1ccc(c3)C(=O)OC)cccc2 |
| XLogP | 3.425 |
| PSA | 42.090 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1480 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 2 - Hydroxy - 3 - Formyl - 7 - Methoxycarbazole |
| PubChem ID | 189687 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Carbazole, Aldehyde, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 241.074 |
| Molecular Formula | C14H11NO3
|
| SMILES | O(c1cc2[nH]c3c(c2cc1)cc(c(O)c3)C=O)C |
| XLogP | 2.329 |
| PSA | 62.320 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1481 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Clauszoline J |
| PubChem ID | NR |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Carbazole, Ether, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 271.084 |
| Molecular Formula | C15H13NO4
|
| SMILES | [nH]1c2c(cc(c(c2)OC)C(=O)O)c2c1cc(cc2)OC |
| XLogP | 2.559 |
| PSA | 71.550 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1482 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | O - Methylated Clausenidin |
| PubChem ID | 504066 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Chromone, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 342.147 |
| Molecular Formula | C20H22O5
|
| SMILES | O1C(CC(=O)c2c1c(C(C)(C)C=C)c1oc(=O)ccc1c2OC)(C)C |
| XLogP | 3.930 |
| PSA | 52.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1509 |
| Compound Structure | |
| Plant Source | Coleonema album (Thunb.) Bartl. &Wendl. Common Name:Cape May, White Confetti Bush |
| Source Family | Rutaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Acetone and ethanol |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) I.M.S. Eldeen, J. Van Staden.Anti-inflammatory and mycobacterial activity of leaf extracts of Coleonema album.South African Journal of Botany, Volume 74, Issue 2, April 2008, Pages 345–347
|
| Curator | |
| Compound ID | 1525 |
| Compound Structure | |
| Plant Source | Commiphora mukul Engl. Common Name:Indian Bdellium tree (English), Guggulu (Sanskrit) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Resin |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 62.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculous glands of neck, asthma, troubles of chest, expectorant, bronchitis, whooping cough, pulmonary tuberculosis |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1526 |
| Compound Structure | |
| Plant Source | Commiphora mukul Engl. Common Name:Indian Bdellium Tree (English), Guggulu (Sanskrit) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Resin |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculous glands of neck, asthma, troubles of chest, expectorant, bronchitis, whooping cough, pulmonary tuberculosis |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |