| Compound ID | 1723 |
| Compound Structure | |
| Plant Source | Exocarpus bidwilli Common Name: |
| Source Family | Santalaceae |
| Origin | New Zealand |
| Plant Part Used | Leaf, seed |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | 96 well - plate format assay for bacteriostatic activity, two - fold serial dilution to measure any background optical density or fluorescence associated with the extract |
| Positive Control Used (conc.) | Rifampin (100 µM), Streptomycin (100 µM) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 20537175 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Earl EA, Altaf M, Murikoli RV, Swift S, O Toole R.Native New Zealand plants with inhibitory activity towards Mycobacterium tuberculosis.BMC Complement Altern Med. 2010 Jun 10;10:25
|
| Curator | |
| Compound ID | 2578 |
| Compound Structure |  |
| Plant Source | Scleropyrum pentandrum Common Name: |
| Source Family | Santalaceae |
| Origin | India, Malaysia, Philippines, Singapore, Sri Lanka |
| Plant Part Used | Twig |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Scleropyric acid |
| PubChem ID | 11594149 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16204994 |
| Extract Preparation | The pulverized, dry twigs (1.06 kg) were extracted successively with n - Hexane, CHCl3 and MeOH in a soxhlet extraction apparatus to yield the hexane (7.12 g), CHCl3 (3.50 g), and MeOH (12.42 g) extracts, respectively |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 264.209 |
| Molecular Formula | C17H28O2 |
| SMILES | OC(=O)CCCCCCCCCCC#CCCC=C |
| XLogP | 6.563 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn A, Buaprom M, Udtip S, Nuntawong N, Haritakun R, Kanokmedhakul S.Antimycobacterial and antiplasmodial unsaturated carboxylic acid from the twigs of Scleropyrum wallichianum.Chem Pharm Bull (Tokyo). 2005 Oct;53(10):1327-9
|
| Curator | |
| Compound ID | 2720 |
| Compound Structure | |
| Plant Source | Thesium hystrix A.W. Hill. Common Name: |
| Source Family | Santalaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Coughs, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Watt, John Mitchell, and Maria Gerdina Breyer-Brandwijk. 1962. The medicinal and poisonous plants of southern and eastern Africa; being an account of their medicinal and other uses, chemical composition, pharmacological effects and toxicology in man and animal. Edinburgh: Livingstone (2nd Edition)
|
| Curator | |
| Compound ID | 4101 |
| Compound Structure |  |
| Plant Source | Exocarpus latifolius Common Name: |
| Source Family | Santalaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 20 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Exocarpic acid |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 274.193 |
| Molecular Formula | C18H26O2 |
| SMILES | C(CCCCCCC(=O)O)C#CC#C/C=C/CCCC |
| XLogP | 6.906 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4102 |
| Compound Structure |  |
| Plant Source | Exocarpus latifolius Common Name: |
| Source Family | Santalaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC220 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Fatty acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 290.188 |
| Molecular Formula | C18H26O3 |
| SMILES | OC(CCCCCCC(=O)O)C#CC#C/C=C/CCCC |
| XLogP | 5.509 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4103 |
| Compound Structure |  |
| Plant Source | Exocarpus latifolius Common Name: |
| Source Family | Santalaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC221 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkyne, Fatty acid, Monoglyceride |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 348.230 |
| Molecular Formula | C21H32O4 |
| SMILES | CCCC/C=C/C#CC#CCCCCCCCC(=O)OCC(O)CO |
| XLogP | 5.846 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |