| Compound ID | 2572 |
| Compound Structure |  |
| Plant Source | Schizandra chinensis Common Name:Japanese Apricot, Japanese Plum, Chinese Plum |
| Source Family | Schisandraceae |
| Origin | China |
| Plant Part Used | Berry |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis 607 |
| Assay / Test Done | Paper Disk Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | 7.1 mm |
| Active Compound Identified | Citric acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Used as traditional Chinese medicine in stopping ulcers and promoting a strong digestive system and heart |
| PubMed ID [Source Literature] | 4978259, 4978260 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 192.027 |
| Molecular Formula | C6H8O7 |
| SMILES | OC(CC(=O)O)(CC(=O)O)C(=O)O |
| XLogP | -2.247 |
| PSA | 132.130 |
| H-bond Donor | 4 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ma TS, Roper R. 1968. Microchemical investigation of medicinal plants. I. The antitubercular principle in Prunus mume and Schizandra chinensis. Mikrochimica Acta (Wien): 167±18
2) Roper R, Ma TS.Microchemical investigation of medicinal plants. II. The antitubercular activity of some plant acids and their hydrazides.Mikrochim Acta. 1968;(1):212-8
|
| Curator | |
