| Compound ID | 1153 |
| Compound Structure | |
| Plant Source | Alpinia galanga (L.) Sw. Common Name:Galanga (English) |
| Source Family | Zingiberaceae |
| Origin | Malaysia |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1600 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Anonymous, 2010c. Khazanah herba warisan bumi: Portal Komuniti Herba
2) Http://www.melur.com/myherba.asp?plant id=94
|
| Curator | |
| Compound ID | 1156 |
| Compound Structure | |
| Plant Source | Alpinia Kumatake Mak. Common Name: |
| Source Family | Zingiberaceae |
| Origin | China |
| Plant Part Used | |
| Extract | Alcohol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:50 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Treatment of flatulence (gas), dyspepsia (stomach upset), vomiting, high blood pressure, gastrointestinal complaints and sea sickness |
| PubMed ID [Source Literature] | 14778141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Wang VF.In vitro antibacterial activity of some common Chinese herbs on Mycobacteria tuberculosis.Chin Med J. 1950 May-Jun;68(5-6):169-72
2) http://www.healthline.com/natstandardcontent/alpinia
|
| Curator | |
| Compound ID | 1543 |
| Compound Structure | |
| Plant Source | Costus sp. Common Name: |
| Source Family | Zingiberaceae |
| Origin | Peru |
| Plant Part Used | Rhizome |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | < 50 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 1577 |
| Compound Structure | |
| Plant Source | Curcuma domesticata Valeton syn. Curcuma longa L. Common Name:Turmeric (English), Haridraa, Priyaka, Haridruma, Kshanda, Gauri (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | < 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, leprosy, random screening |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278
|
| Curator | |
| Compound ID | 1578 |
| Compound Structure | |
| Plant Source | Curcuma domesticata Valeton syn. Curcuma longa L. Common Name:Turmeric (English), Haridraa, Priyaka, Haridruma, Kshanda, Gauri (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:80 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, leprosy, random screening |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278
|
| Curator | |
| Compound ID | 1606 |
| Compound Structure | |
| Plant Source | Dimerocostus sp. Common Name: |
| Source Family | Zingiberaceae |
| Origin | Peru |
| Plant Part Used | Leaf |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | 56 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 1971 |
| Compound Structure |  |
| Plant Source | Kaempferia parviflora Common Name:Krachai Dhum |
| Source Family | Zingiberaceae |
| Origin | Asia |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3, 5, 7, 4' - Tetramethoxyflavone |
| PubChem ID | 631095 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | 14693228 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB (oral human epidermoid carcinoma), BC (breast cancer), and NCI-H187 (human, small cell lung cancer) cell lines |
| Molecular Weight | 342.110 |
| Molecular Formula | C19H18O6
|
| SMILES | O1c2c(c(=O)c(OC)c1c1ccc(OC)cc1)c(OC)cc(OC)c2 |
| XLogP | 3.059 |
| PSA | 53.990 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Yenjai C, Prasanphen K, Daodee S, Wongpanich V, Kittakoop P.Bioactive flavonoids from Kaempferia parviflora.Fitoterapia. 2004 Jan;75(1):89-92
|
| Curator | |
| Compound ID | 1972 |
| Compound Structure |  |
| Plant Source | Kaempferia parviflora Common Name:Krachai Dhum |
| Source Family | Zingiberaceae |
| Origin | Asia |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulfate (2.0 – 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7, 4` - Trimethoxyflavone |
| PubChem ID | 79730 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | 14693228 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB (oral human epidermoid carcinoma), BC (breast cancer), and NCI-H187 (human, small cell lung cancer) cell lines |
| Molecular Weight | 312.100 |
| Molecular Formula | C18H16O5 |
| SMILES | O1c2c(c(OC)cc(OC)c2)c(=O)cc1c1ccc(OC)cc1 |
| XLogP | 2.683 |
| PSA | 44.760 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Yenjai C, Prasanphen K, Daodee S, Wongpanich V, Kittakoop P.Bioactive flavonoids from Kaempferia parviflora.Fitoterapia. 2004 Jan;75(1):89-92
|
| Curator | |
| Compound ID | 2487 |
| Compound Structure | |
| Plant Source | Renealmia sp. Common Name: |
| Source Family | Zingiberaceae |
| Origin | Peru |
| Plant Part Used | Rhizome, leaf |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) radiometric assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | < 51 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 2831 |
| Compound Structure | |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 85 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) R.D. Hiserodt,S.G. Franzblau and R.T. Rosen.Isolation of 6-, 8-, and 10-Gingerol from Ginger Rhizome by HPLC and Preliminary Evaluation of Inhibition of Mycobacterium avium and Mycobacterium tuberculosis.J. Agric. Food Chem., 1998, 46 (7), pp 2504–2508
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
3) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278
|
| Curator | |
| Compound ID | 2833 |
| Compound Structure |  |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 10 - Gingerol |
| PubChem ID | 168115 |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Ketone, Ether, Phenol, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 350.246 |
| Molecular Formula | C21H34O4 |
| SMILES | O[C@@H](CCCCCCCCC)CC(=O)CCc1cc(OC)c(O)cc1 |
| XLogP | 5.163 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) R.D. Hiserodt,S.G. Franzblau and R.T. Rosen.Isolation of 6-, 8-, and 10-Gingerol from Ginger Rhizome by HPLC and Preliminary Evaluation of Inhibition of Mycobacterium avium and Mycobacterium tuberculosis.J. Agric. Food Chem., 1998, 46 (7), pp 2504–2508
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
3) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278.
|
| Curator | |
| Compound ID | 2834 |
| Compound Structure |  |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 10 - Gingerol |
| PubChem ID | 168115 |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Ketone, Ether, Phenol, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 350.246 |
| Molecular Formula | C21H34O4 |
| SMILES | O[C@@H](CCCCCCCCC)CC(=O)CCc1cc(OC)c(O)cc1 |
| XLogP | 5.163 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) R.D. Hiserodt,S.G. Franzblau and R.T. Rosen.Isolation of 6-, 8-, and 10-Gingerol from Ginger Rhizome by HPLC and Preliminary Evaluation of Inhibition of Mycobacterium avium and Mycobacterium tuberculosis.J. Agric. Food Chem., 1998, 46 (7), pp 2504–2508
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
3) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278.
|
| Curator | |
| Compound ID | 2835 |
| Compound Structure |  |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 8 - Gingerol |
| PubChem ID | 5275725 |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Ketone, Ether, Alcohol, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 322.214 |
| Molecular Formula | C19H30O4 |
| SMILES | OC(CCCCCCC)CC(=O)CCc1cc(OC)c(O)cc1 |
| XLogP | 4.025 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) R.D. Hiserodt,S.G. Franzblau and R.T. Rosen.Isolation of 6-, 8-, and 10-Gingerol from Ginger Rhizome by HPLC and Preliminary Evaluation of Inhibition of Mycobacterium avium and Mycobacterium tuberculosis.J. Agric. Food Chem., 1998, 46 (7), pp 2504–2508
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
3) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278.
|
| Curator | |
| Compound ID | 2836 |
| Compound Structure |  |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Gingerol |
| PubChem ID | 3473 |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Butenolide, Lactone, Alkene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 294.183 |
| Molecular Formula | C17H26O4 |
| SMILES | OC(CCCCC)CC(=O)CCc1cc(OC)c(O)cc1 |
| XLogP | 2.887 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) R.D. Hiserodt,S.G. Franzblau and R.T. Rosen.Isolation of 6-, 8-, and 10-Gingerol from Ginger Rhizome by HPLC and Preliminary Evaluation of Inhibition of Mycobacterium avium and Mycobacterium tuberculosis.J. Agric. Food Chem., 1998, 46 (7), pp 2504–2508
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
3) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278.
|
| Curator | |
| Compound ID | 2837 |
| Compound Structure | |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1600 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | 21094237 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mohamad S, Zin NM, Wahab HA, Ibrahim P, Sulaiman SF, Zahariluddin AS, Noor SS.Antituberculosis potential of some ethnobotanically selected Malaysian plants.J Ethnopharmacol. 2011 Feb 16;133(3):1021-6
|
| Curator | |
| Compound ID | 2838 |
| Compound Structure | |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Methylene chloride |
| Target Bacteria | |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 85 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | 21094237 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mohamad S, Zin NM, Wahab HA, Ibrahim P, Sulaiman SF, Zahariluddin AS, Noor SS.Antituberculosis potential of some ethnobotanically selected Malaysian plants.J Ethnopharmacol. 2011 Feb 16;133(3):1021-6
|
| Curator | |
| Compound ID | 2863 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asian countries |
| Plant Part Used | Dried rhizome |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1961 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Demethoxycurcumin |
| PubChem ID | 5324476 |
| Ethnomedicinal Information | Folk medicine, Antioxidant, anti - HIV, antimutagenic, antiangiogenic, antimalarial, antitubercular, antiandrogenic, COX inhibitory activities |
| PubMed ID [Source Literature] | 20027668 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 338.115 |
| Molecular Formula | C20H18O5 |
| SMILES | O(c1cc(ccc1O)/C=C/C(=C/C(=O)/C=C/c1ccc(O)cc1)/O)C |
| XLogP | 3.610 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Agrawal DK, Mishra PK.Curcumin and its analogues: potential anticancer agents.Med Res Rev. 2010 Sep;30(5):818-60
|
| Curator | Reshmi |
| Compound ID | 2989 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M3 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 0.39 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Lekha Raveendran, wvarsha |
| Compound ID | 2990 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M4 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, Lekha Raveendran |
| Compound ID | 2991 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M5 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2992 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M6 (MDR (Multi - drug - resistant) strains which are Isoniazid and Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 0.78 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2993 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M8 (Isoniazid, Rifampin, Ethambutol, Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2994 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M11 (MDR (Multi - drug - resistant) strains which are Isoniazid and Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2995 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M16 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2996 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M21 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin, Ethambutol and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |