| Compound ID | 1003 |
| Compound Structure | |
| Plant Source | Abrus precatorius L. Common Name:Indian Wild Liquorice, Jequirity, Crab's Eye (English), Gunja, Gunjaka (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Puerto Rico, Nigeria |
| Plant Part Used | |
| Extract | Hexane (21.33 %) |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculous glands, asthma, pain in chest, cough, bronchitis, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Ibrahim, K., Oyewale, A.O., Amupitan, J.O., and Okogun, J.I., 2009, Antimycobacterial activity of some medicinal plants in Niger State, Nigeria. Afri. J. Infect. Dis., 3(2), 44-48
2) Indian Medicinal Plants: An Illustrated Dictionary By C.P. Khare
|
| Curator | |
| Compound ID | 1004 |
| Compound Structure | |
| Plant Source | Abrus precatorius L. Common Name:Indian wild liquorice, Jequirity, Crab's Eye (English), Gunja, Gunjaka (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Puerto Rico, Nigeria |
| Plant Part Used | Stem |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Middlebrook 7H9 Broth using BACTEC 460 System |
| Positive Control Used (conc.) | Rifampin (1 µg/ml) |
| Inhibition [%] | 42 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculous glands, asthma, pain in chest, cough, bronchitis, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun, M.D., Ramos, Z., Vazques, J., Oquendo, I., Proctor, G.R., Gerena, L., Franzblau, S.G., 2001. Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities. Phytotherapy Research 15, 638–642
2) Indian Medicinal Plants: An Illustrated Dictionary By C.P. Khare
|
| Curator | |
| Compound ID | 1005 |
| Compound Structure |  |
| Plant Source | Abrus precatorius L. Common Name:Indian wild liquorice, Jequirity, Crab's Eye (English), Gunja, Gunjaka (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Puerto Rico, Nigeria |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Abruquinone B |
| PubChem ID | 44257521 |
| Ethnomedicinal Information | Tuberculous glands, asthma, pain in chest, cough, bronchitis, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 15114511 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Benzopyran, Quinone, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 390.131 |
| Molecular Formula | C20H22O8 |
| SMILES | O1CC(Cc2c1c(OC)c(OC)c(OC)c2)C1=CC(=O)C(=C(OC)C1=O)OC |
| XLogP | 0.780 |
| PSA | 89.520 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) Limmatvapirat C, Sirisopanaporn S, Kittakoop P.Antitubercular and antiplasmodial constituents of Abrus precatorius.Planta Med. 2004 Mar;70(3):276-8
2) Indian Medicinal Plants: An Illustrated Dictionary By C.P. Khare
|
| Curator | |
