| Compound ID | 3975 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name: |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium abcessus (ATCC 19977) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (128 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O
|
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | |
| Compound ID | 3974 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name: |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (4 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O
|
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | |
| Compound ID | 3796 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O |
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3797 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (0.25 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 8 - Hydroxy Canthin - 6 - One |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 235.063 |
| Molecular Formula | C15H9NO2 |
| SMILES | C1ccc(c2c1c1c3n2c(=O)ccc3ccc1)O |
| XLogP | 2.854 |
| PSA | 42.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3799 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.25 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O |
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3800 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.25 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O |
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3990 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name: |
| Source Family | Amaryllidaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis (mc22700) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | NPMC34c |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Quinoline, Amide, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 236.059 |
| Molecular Formula | C14H8N2O2 |
| SMILES | O=c1n2c3c(c4c2c(O)ccc4)ccnc3cc1 |
| XLogP | 1.635 |
| PSA | 55.120 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |