| Compound ID | 3843 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (bovine isolate [NCTC 8578]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 74 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 5 - Dihydroxybenzaldehyde |
| PubChem ID | 70949 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Aldehyde, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 138.032 |
| Molecular Formula | C7H6O3 |
| SMILES | Oc1c(cc(O)cc1)C=O |
| XLogP | 0.950 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3844 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (human isolate [ATCC 43015]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 74 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 5 - Dihydroxybenzaldehyde |
| PubChem ID | 70949 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Aldehyde, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 138.032 |
| Molecular Formula | C7H6O3 |
| SMILES | Oc1c(cc(O)cc1)C=O |
| XLogP | 0.950 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3845 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (raw - milk isolate [806R]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 74 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 5 - Dihydroxybenzaldehyde |
| PubChem ID | 70949 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Aldehyde, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 138.032 |
| Molecular Formula | C7H6O3 |
| SMILES | Oc1c(cc(O)cc1)C=O |
| XLogP | 0.950 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3846 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (bovine isolate [NCTC 8578]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 90.4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - Hydroxy - 5 - Methoxybenzaldehyde |
| PubChem ID | 95695 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Aldehyde, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 152.047 |
| Molecular Formula | C8H8O3 |
| SMILES | O(c1cc(c(O)cc1)C=O)C |
| XLogP | 1.469 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3847 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (human isolate [ATCC 43015]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 90.4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - Hydroxy - 5 - Methoxybenzaldehyde |
| PubChem ID | 95695 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Aldehyde, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 152.047 |
| Molecular Formula | C8H8O3 |
| SMILES | O(c1cc(c(O)cc1)C=O)C |
| XLogP | 1.469 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3848 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (raw - milk isolate [806R]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 90.4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - Hydroxy - 5 - Methoxybenzaldehyde |
| PubChem ID | 95695 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Aldehyde, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 152.047 |
| Molecular Formula | C8H8O3 |
| SMILES | O(c1cc(c(O)cc1)C=O)C |
| XLogP | 1.469 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3849 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (bovine isolate [NCTC 8578]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 72.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Carvacrol |
| PubChem ID | 10364 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Terpene, Monoterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 150.104 |
| Molecular Formula | C10H14O |
| SMILES | Oc1cc(C(C)C)ccc1C |
| XLogP | 3.556 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3850 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (human isolate [ATCC 43015]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 72.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Carvacrol |
| PubChem ID | 10364 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Terpene, Monoterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 150.104 |
| Molecular Formula | C10H14O |
| SMILES | Oc1cc(C(C)C)ccc1C |
| XLogP | 3.556 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3851 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (raw - milk isolate [806R]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 72.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Carvacrol |
| PubChem ID | 10364 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Terpene, Monoterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 150.104 |
| Molecular Formula | C10H14O |
| SMILES | Oc1cc(C(C)C)ccc1C |
| XLogP | 3.556 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3852 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (bovine isolate [NCTC 8578]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 26.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cinnamon (Cassia) oil |
| PubChem ID | 6850781 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Mixture, Alkene, Phenol, OIL |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 164.084 |
| Molecular Formula | C19H22O2 |
| SMILES | O(c1cc(CC=C)ccc1O)C.c1(ccccc1)/C=C/C |
| XLogP | 2.484 |
| PSA | 29.460 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3853 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (human isolate [ATCC 43015]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 26.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cinnamon (Cassia) oil |
| PubChem ID | 6850781 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Mixture, Alkene, Phenol, OIL |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 164.084 |
| Molecular Formula | C19H22O2 |
| SMILES | O(c1cc(CC=C)ccc1O)C.c1(ccccc1)/C=C/C |
| XLogP | 2.484 |
| PSA | 29.460 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3854 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (raw - milk isolate [806R]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 26.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cinnamon (Cassia) oil |
| PubChem ID | 6850781 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Mixture, Alkene, Phenol, OIL |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 164.084 |
| Molecular Formula | C19H22O2 |
| SMILES | O(c1cc(CC=C)ccc1O)C.c1(ccccc1)/C=C/C |
| XLogP | 2.484 |
| PSA | 29.460 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3855 |
| Compound Structure | NR |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (bovine isolate [NCTC 8578]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 68.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Oregano (Origanum) oil (Mixture) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | NR |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3856 |
| Compound Structure | NR |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (human isolate [ATCC 43015]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 68.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Oregano (Origanum) oil (Mixture) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | NR |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3857 |
| Compound Structure | NR |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (raw - milk isolate [806R]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 68.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Oregano (Origanum) oil (Mixture) |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | NR |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3858 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (bovine isolate [NCTC 8578]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25.9 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Trans - Cinnamaldehyde |
| PubChem ID | 637511 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Aldehyde |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 132.058 |
| Molecular Formula | C9H8O |
| SMILES | O=C/C=C/c1ccccc1 |
| XLogP | 3.985 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3859 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (human isolate [ATCC 43015]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25.9 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Trans - Cinnamaldehyde |
| PubChem ID | 637511 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Aldehyde |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 132.058 |
| Molecular Formula | C9H8O |
| SMILES | O=C/C=C/c1ccccc1 |
| XLogP | 3.985 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3860 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (raw - milk isolate [806R]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25.9 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Trans - Cinnamaldehyde |
| PubChem ID | 637511 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Aldehyde |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 132.058 |
| Molecular Formula | C9H8O |
| SMILES | O=C/C=C/c1ccccc1 |
| XLogP | 3.985 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |