| Compound ID | 3388 |
| Compound Structure |  |
| Plant Source | Chrysoma pauciflosculosa (Michx.) Greene Common Name:NR |
| Source Family | Asteraceae (Compositae) |
| Origin | NR |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (2E, 8Z) Matricaria ester |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9810277 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Ester |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 174.068 |
| Molecular Formula | C11H8O2 |
| SMILES | C(#CC#C/C=C/[CH])/C=C/C(=O)OC |
| XLogP | 3.071 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Cantrell CL, Robbs SL, Franzblau SG, Fischer NH.Antimycobacterial matricaria esters and lactones from Astereae species.Planta Med. 1998 Oct;64(7):665-7
|
| Curator | Farzana-shamsudeen, vikramjitmandal |
| Compound ID | 3389 |
| Compound Structure |  |
| Plant Source | Chrysoma pauciflosculosa (Michx.) Greene Common Name:NR |
| Source Family | Asteraceae (Compositae) |
| Origin | NR |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (2Z, 8Z) Matricaria ester |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9810277 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Ester, Acyl |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 272.105 |
| Molecular Formula | C16H16O4 |
| SMILES | C(#CC#C/C=C/COC(=O)/C(=C/C)/C)/C=C/C(=O)OC |
| XLogP | 3.138 |
| PSA | 52.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Cantrell CL, Robbs SL, Franzblau SG, Fischer NH.Antimycobacterial matricaria esters and lactones from Astereae species.Planta Med. 1998 Oct;64(7):665-7
|
| Curator | Farzana-shamsudeen, vikramjitmandal |