| Compound ID | 1514 |
| Compound Structure |  |
| Plant Source | Combretum imberbe Wawra Common Name:Leadwood |
| Source Family | Combretaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Imberbic acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Combretum species used for chest coughs, fever, infections |
| PubMed ID [Source Literature] | 12657301 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Triterpene, Hydroxy, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 472.355 |
| Molecular Formula | C30H48O4 |
| SMILES | C1([C@H]2[C@@]([C@@H]3[C@@](CC2)([C@]2(C(=CC3)[C@H]3[C@@](CC2)(CC[C@](C3)(C(=O)O)C)C)C)C)([C@H](C[C@@H]1O)O)C)(C)C |
| XLogP | 7.389 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Katerere DR, Gray AI, Nash RJ, Waigh RD.Antimicrobial activity of pentacyclic triterpenes isolated from African Combretaceae.Phytochemistry. 2003 May;63(1):81-8
|
| Curator | |
