| Compound ID | 3412 |
| Compound Structure |  |
| Plant Source | Glycyrrhiza inflata Common Name:Chinese Licorice |
| Source Family | Fabaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | < 20 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Licochalcone A |
| PubChem ID | 5318998 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 12058317 |
| Extract Preparation | Soxhlet extraction, concentrated in vacuo to dryness |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Chalcone, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4 |
| SMILES | Oc1c(C(C)(C)C=C)cc(c(OC)c1)/C=C/C(=O)c1ccc(O)cc1 |
| XLogP | 4.443 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Friis-Møller A, Chen M, Fuursted K, Christensen SB, Kharazmi A.In vitro antimycobacterial and antilegionella activity of licochalcone A from Chinese licorice roots.Planta Med. 2002 May;68(5):416-9
|
| Curator | Gppreetha, vikramjitmandal |
