| Compound ID | 2043 |
| Compound Structure |  |
| Plant Source | Limnophila geoffrayi Common Name:Geoffrey's Marshweed |
| Source Family | Scrophulariaceae |
| Origin | Thailand |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin Sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Nevadensin |
| PubChem ID | 160921 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 14609129 |
| Extract Preparation | The pulverized, dried aerial plant material (615 g) was extracted successively with n-hexane, CHCl3 and MeOH in a Soxhlet apparatus to give the hexane (7.52 g), CHCl3 (7.79 g) and MeOH (50.10 g) extracts, respectively |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 344.090 |
| Molecular Formula | C18H16O7
|
| SMILES | O1c2c(c(O)c(OC)c(O)c2OC)c(=O)cc1c1ccc(OC)cc1 |
| XLogP | 0.757 |
| PSA | 85.220 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn A, Poomsing P, Aroonrerk N, Punjanon T, Suksamrarn S, Kongkun S.Antimycobacterial and antioxidant flavones from Limnophila geoffrayi.Arch Pharm Res. 2003 Oct;26(10):816-20
2) http://www.oswaldasia.org/species/l/limge/limge_en.html
|
| Curator | |
| Compound ID | 2044 |
| Compound Structure |  |
| Plant Source | Limnophila geoffrayi Common Name:Geoffrey's Marshweed |
| Source Family | Scrophulariaceae |
| Origin | Thailand |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin Sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Isothymusin |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 14609129 |
| Extract Preparation | The pulverized, dried aerial plant material (615 g) was extracted successively with n-hexane, CHCl3 and MeOH in a Soxhlet apparatus to give the hexane (7.52 g), CHCl3 (7.79 g) and MeOH (50.10 g) extracts, respectively |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 330.074 |
| Molecular Formula | C17H14O7
|
| SMILES | C1(c(c(c(c2c1oc(cc2=O)c1ccc(cc1)O)O)OC)OC)O |
| XLogP | 0.595 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn A, Poomsing P, Aroonrerk N, Punjanon T, Suksamrarn S, Kongkun S.Antimycobacterial and antioxidant flavones from Limnophila geoffrayi.Arch Pharm Res. 2003 Oct;26(10):816-20
2) http://www.oswaldasia.org/species/l/limge/limge_en.html
|
| Curator | |
