| Compound ID | 3047 |
| Compound Structure |  |
| Plant Source | Peucedanum osthruthin Koch Common Name: |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Umbelliferone |
| PubChem ID | 5281426 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 162.032 |
| Molecular Formula | C9H6O3
|
| SMILES | O1c2c(ccc(O)c2)ccc1=O |
| XLogP | 2.056 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | Vikramjitmandal |
| Compound ID | 3048 |
| Compound Structure |  |
| Plant Source | Peucedanum osthruthin Koch Common Name: |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium abscessus (ATCC 19 977) |
| Assay / Test Done | |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ostruthin |
| PubChem ID | 5281420 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 298.157 |
| Molecular Formula | C19H22O3
|
| SMILES | O1c2c(cc(C/C=C(/CCC=C(C)C)C)c(O)c2)ccc1=O |
| XLogP | 5.348 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | |
