| Compound ID | 2317 |
| Compound Structure |  |
| Plant Source | Peucedanum ostruthium Koch Common Name:Masterwort |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | China |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium aurum (PI 104 482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ostruthin |
| PubChem ID | 5281420 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 298.157 |
| Molecular Formula | C19H22O3 |
| SMILES | O1c2c(cc(C/C=C(/CCC=C(C)C)C)c(O)c2)ccc1=O |
| XLogP | 5.348 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | |
| Compound ID | 2318 |
| Compound Structure |  |
| Plant Source | Peucedanum ostruthium Koch Common Name:Masterwort |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | China |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ostruthin |
| PubChem ID | 5281420 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 298.157 |
| Molecular Formula | C19H22O3 |
| SMILES | O1c2c(cc(C/C=C(/CCC=C(C)C)C)c(O)c2)ccc1=O |
| XLogP | 5.348 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | |
| Compound ID | 2319 |
| Compound Structure |  |
| Plant Source | Peucedanum ostruthium Koch Common Name:Masterwort |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | China |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium phlei (ATCC 11 758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ostruthin |
| PubChem ID | 5281420 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 298.157 |
| Molecular Formula | C19H22O3 |
| SMILES | O1c2c(cc(C/C=C(/CCC=C(C)C)C)c(O)c2)ccc1=O |
| XLogP | 5.348 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | |
| Compound ID | 2320 |
| Compound Structure |  |
| Plant Source | Peucedanum ostruthium Koch Common Name:Masterwort |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | China |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ostruthin |
| PubChem ID | 5281420 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 298.157 |
| Molecular Formula | C19H22O3 |
| SMILES | O1c2c(cc(C/C=C(/CCC=C(C)C)C)c(O)c2)ccc1=O |
| XLogP | 5.348 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | |