| Compound ID | 3973 |
| Compound Structure |  |
| Plant Source | Rudbeckia laciniata Common Name:Thimbleweed |
| Source Family | Asteraceae (Compositae) |
| Origin | Eastern North America |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 2,10-bisaboladiene- 1,4-endoperoxide |
| PubChem ID | 10082849 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16243360 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene, Peroxy, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 236.178 |
| Molecular Formula | C15H24O2 |
| SMILES | O1O[C@@H]2C[C@@H](C(CCC=C(C)C)C)[C@@H]1C=C2C |
| XLogP | 4.400 |
| PSA | 18.460 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Pauli GF, Case RJ, Inui T, Wang Y, Cho S, Fischer NH, Franzblau SG.New perspectives on natural products in TB drug research.Life Sci. 2005 Dec 22;78(5):485-94
|
| Curator | |
| Compound ID | 3118 |
| Compound Structure | |
| Plant Source | Rudbeckia laciniata Common Name:Thimbleweed |
| Source Family | Asteraceae (Compositae) |
| Origin | Eastern North America |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2,10-bisaboladiene- 1,4-endoperoxide |
| PubChem ID | 10082849 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16243360 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene, Peroxy, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 236.178 |
| Molecular Formula | C15H24O2 |
| SMILES | O1O[C@@H]2C[C@@H](C(CCC=C(C)C)C)[C@@H]1C=C2C |
| XLogP | 4.400 |
| PSA | 18.460 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Pauli GF, Case RJ, Inui T, Wang Y, Cho S, Fischer NH, Franzblau SG.New perspectives on natural products in TB drug research.Life Sci. 2005 Dec 22;78(5):485-94
|
| Curator | KeyaMukherjee, reshmi |
