| Compound ID | 3587 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostanol |
| PubChem ID | 10048103 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthonoid, Benzopyran, Prenylated, Phenol, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 426.168 |
| Molecular Formula | C24H26O7 |
| SMILES | O1C(C(O)Cc2c1cc1oc3c(c(=O)c1c2O)c(CC=C(C)C)c(OC)c(O)c3)(C)C |
| XLogP | 1.883 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
