| Compound ID | 3093 |
| Compound Structure |  |
| Plant Source | Prismatomeris fragrans E.T. Geddes Common Name:Khao - San |
| Source Family | Rubiaceae |
| Origin | Northeastern, Eastern and Southeastern parts of Thailand and in the Northwest of Laos |
| Plant Part Used | Root, stem |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin Sulphate (2.5 µg/ml), Isoniazid (0.05 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 1 - Hydroxy - 2 - Hydroxymethyl - 3 - Methoxyanthraquinone |
| PubChem ID | 10085264 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 15885942 |
| Extract Preparation | Air dried roots and stems ground and extracted with solvents hexane and dichloromethane |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Anthraquinone, Alcohol, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against human epidermoid carcinoma in the mouth (KB), human breast cancer cells (BC), human lung cancer cells (NCI - H187) |
| Molecular Weight | 284.068 |
| Molecular Formula | C16H12O5 |
| SMILES | O(c1c(c(O)c2c(C(=O)c3c(C2=O)cccc3)c1)CO)C |
| XLogP | 1.654 |
| PSA | 83.830 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul K, Kanokmedhakul S, Phatchana R.Biological activity of Anthraquinones and Triterpenoids from Prismatomeris fragrans.J Ethnopharmacol. 2005 Sep 14;100(3):284-8
|
| Curator | KeyaMukherjee, vsheeba |
