| Compound ID | 3801 |
| Compound Structure |  |
| Plant Source | Diospyros anisandra Common Name: |
| Source Family | Ebenaceae |
| Origin | Mexico |
| Plant Part Used | Stem bark |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06–2.00 µg/ml), Ofloxacin (0.50–16.00 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Plumbagin |
| PubChem ID | 10205 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17498888 |
| Extract Preparation | Hexane and dichloromethane extracts |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Napthalene, Quinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 188.047 |
| Molecular Formula | C11H8O3 |
| SMILES | Oc1c2c(C(=O)C(=CC2=O)C)ccc1 |
| XLogP | 0.756 |
| PSA | 54.370 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Borges-Argáez R, Canche-Chay CI, Peña-Rodríguez LM, Said-Fernández S, Molina-Salinas GM.Antimicrobial activity of Diospyros anisandra.Fitoterapia. 2007 Jul;78(5):370-2. Epub 2007 Apr 11
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3802 |
| Compound Structure | |
| Plant Source | Diospyros anisandra Common Name: |
| Source Family | Ebenaceae |
| Origin | Mexico |
| Plant Part Used | Stem bark |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (CIBIN / UMF15 : 099) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06–2.00 µg/ml), Ofloxacin (0.50–16.00 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Plumbagin |
| PubChem ID | 10205 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17498888 |
| Extract Preparation | Hexane and dichloromethane extracts |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Napthalene, Quinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 188.047 |
| Molecular Formula | C11H8O3 |
| SMILES | Oc1c2c(C(=O)C(=CC2=O)C)ccc1 |
| XLogP | 0.756 |
| PSA | 54.370 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Borges-Argáez R, Canche-Chay CI, Peña-Rodríguez LM, Said-Fernández S, Molina-Salinas GM.Antimicrobial activity of Diospyros anisandra.Fitoterapia. 2007 Jul;78(5):370-2. Epub 2007 Apr 11
|
| Curator | Vsheeba, vikramjitmandal |
