| Compound ID | 3670 |
| Compound Structure |  |
| Plant Source | Micromelum hirsutum Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | Rifampin (0.040 ± 0.017 µg/ml) |
| Inhibition [%] | > 90 % |
| Activity [MIC] µg/ml | 1.5 ± 0.4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (-) - Z - 9 - Octadecene - 4 - Olide [Micromolide] |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15770548 |
| Extract Preparation | The dried, milled stem bark of Micromelum hirsutum was extracted with CH2Cl2 to yield 45.5 g extract, of which 32.1 g were chromatographed by vacuum liquid chromatography over a silica gel column |
| Chemical Classification [Active Compound] | Alicyclic, Butenolide, Lactone, Alkene |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | O1C(=O)CCC1CCCC/C=CCCCCCCCC |
| XLogP | 7.349 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Ma C, Case RJ, Wang Y, Zhang HJ, Tan GT, Van Hung N, Cuong NM, Franzblau SG, Soejarto DD, Fong HH, Pauli GF.Anti-tuberculosis constituents from the stem bark of Micromelum hirsutum.Planta Med. 2005 Mar;71(3):261-7
|
| Curator | Vikramjitmandal |
