| Compound ID | 3415 |
| Compound Structure |  |
| Plant Source | Piper chaba Hunter Common Name: |
| Source Family | Piperaceae |
| Origin | |
| Plant Part Used | Stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Chabamide |
| PubChem ID | 11319094 |
| Ethnomedicinal Information | Chabamide showed antimalarial activity with an IC50 value of 2.7 µg/ml |
| PubMed ID [Source Literature] | 12357406 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Alkaloid, Pyrrolidine |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 570.273 |
| Molecular Formula | C34H38N2O6 |
| SMILES | O=C(N1CCCCC1)[C@H]1[C@@H]([C@@H](C=CC1C(=O)N1CCCCC1)c1cc2OCOc2cc1)/C=C/c1cc2OCOc2cc1 |
| XLogP | 5.216 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 7 |
| No. of N | 2 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Prabpai S, Champung P, Suksamrarn A.Chabamide, a novel piperine dimer from stems of Piper chaba.Planta Med. 2002 Sep;68(9):853-5
|
| Curator | Rachana, vikramjitmandal |
