| Compound ID | 3669 |
| Compound Structure |  |
| Plant Source | Engelhardia roxburghiana Hay Common Name: |
| Source Family | Juglandaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Engelhardione |
| PubChem ID | 11404174 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15729627 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Ketone, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 312.136 |
| Molecular Formula | C19H20O4 |
| SMILES | O1c2cc(CCCCC(=O)CCc3cc1c(O)cc3)ccc2O |
| XLogP | 3.415 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Lin WY, Peng CF, Tsai IL, Chen JJ, Cheng MJ, Chen IS.Antitubercular constituents from the roots of Engelhardia roxburghiana.Planta Med. 2005 Feb;71(2):171-5
|
| Curator | Vsheeba, vikramjitmandal |
