| Compound ID | 2415 |
| Compound Structure |  |
| Plant Source | Polyalthia cerasoides (Roxb.) Benth. ex Bedd Common Name: |
| Source Family | Annonaceae |
| Origin | Thailand |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.05 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Octadeca - 9, 11, 13 - Triynoic Acid |
| PubChem ID | 11778027 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 17845001 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkyne, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 272.178 |
| Molecular Formula | C18H24O2 |
| SMILES | OC(=O)CCCCCCCC#CC#CC#CCCCC |
| XLogP | 6.542 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul S, Kanokmedhakul K, Lekphrom R.Bioactive constituents of the roots of Polyalthia cerasoides.J Nat Prod. 2007 Sep;70(9):1536-8
|
| Curator | |
