| Compound ID | 3710 |
| Compound Structure |  |
| Plant Source | Kaempferia marginata Common Name:Tup Mup |
| Source Family | Zingiberaceae |
| Origin | Thailand |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml), Rifampin (0.0023 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sandaracopimaradien - 1α - 2α - Diol |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16309313 |
| Extract Preparation | The dried and milled whole plant (619 g) was extracted three times (3 × 2 l) by maceration with MeOH at room temperature. After filtration and evaporation of the solvent under reduced pressure, the combined crude MeOH extract was partitioned between CH2Cl2 and H2O to afford CH2Cl2 (41 g) and H2O - MeOH (22.8 g) extracts. The CH2Cl2 - soluble extract was subjected to silica gel column chromatography to yield the fractions |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 318.256 |
| Molecular Formula | C21H34O2
|
| SMILES | C1=C2[C@](CC[C@]1(C)C=C)([C@]1(CC[C@H](O)[C@]([C@@]1(CC2)C)(C)O)C)C |
| XLogP | 6.431 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Thongnest S, Mahidol C, Sutthivaiyakit S, Ruchirawat S.Oxygenated pimarane diterpenes from Kaempferia marginata.J Nat Prod. 2005 Nov;68(11):1632-6
|
| Curator | Gppreetha |