| Compound ID | 3065 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4-α-(15)-Epoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | C1(=C)[C@H]2[C@@H]([C@@H]3[C@@H](CC1)C(=C)C(=O)O3)[C@]1(CC2)CO1 |
| XLogP | 1.715 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
