| Compound ID | 2862 |
| Compound Structure |  |
| Plant Source | Helichrysum aureonitens Common Name:Golden Everlasting |
| Source Family | Asteraceae (Compositae) |
| Origin | Africa |
| Plant Part Used | Callus tissue from young leaf |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27264) |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | Isoniazid (0.2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4 - Chloro - 2 - (Hepta - 1, 3, 5 - Triyn - 1 - yl) - Phenol |
| PubChem ID | NR |
| Ethnomedicinal Information | Anticancer activity, inhibition on DNA topoisomerase I |
| PubMed ID [Source Literature] | 19881282 |
| Extract Preparation | Cell suspension culture |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkyne, Phenol, Haloginated |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against Vero and Human prostate epithelial carcinoma DU 145 cell lines |
| Molecular Weight | 214.019 |
| Molecular Formula | C13H7ClO |
| SMILES | C1(cc(c(cc1)O)C#CC#CC#CC)Cl |
| XLogP | 3.971 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Ziaratnia SM, Ohyama K, Hussein AA, Muranaka T, Lall N, Kunert KJ, Meyer JJ.Isolation and identification of a novel chlorophenol from a cell suspension culture of Helichrysum aureonitens.Chem Pharm Bull (Tokyo). 2009 Nov;57(11):1282-3
|
| Curator | Gppreetha, keyamukherjee, reshmi |
