| Compound ID | 1815 |
| Compound Structure |  |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin (0.23 ± 0.06 µg/ml), Isoniazid (0.116 ± 0.03 µg/ml), Streptomycin (2.7 ± 0.36 µg/ml), Ethambutol (0.116 ± 0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 29.16 ± 3.61 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Glabridin |
| PubChem ID | 124052 |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 18182260 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzopyran, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C[C@H](Cc2c1c1c(OC(C=C1)(C)C)cc2)c1c(O)cc(O)cc1 |
| XLogP | 3.207 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gupta VK, Fatima A, Faridi U, Negi AS, Shanker K, Kumar JK, Rahuja N, Luqman S, Sisodia BS, Saikia D, Darokar MP, Khanuja SP.Antimicrobial potential of Glycyrrhiza glabra roots.J Ethnopharmacol. 2008 Mar 5;116(2):377-80
|
| Curator | |
| Compound ID | 3971 |
| Compound Structure | |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin (0.23 ± 0.06 µg/ml), Isoniazid (0.116 ± 0.03 µg/ml), Streptomycin (2.7 ± 0.36 µg/ml), Ethambutol (0.116 ± 0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 29.16 ± 3.61 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Glabridin |
| PubChem ID | 124052 |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzopyran, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C[C@H](Cc2c1c1c(OC(C=C1)(C)C)cc2)c1c(O)cc(O)cc1 |
| XLogP | 3.207 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gupta VK, Fatima A, Faridi U, Negi AS, Shanker K, Kumar JK, Rahuja N, Luqman S, Sisodia BS, Saikia D, Darokar MP, Khanuja SP.Antimicrobial potential of Glycyrrhiza glabra roots.J Ethnopharmacol. 2008 Mar 5;116(2):377-80
|
| Curator | |
