| Compound ID | 2075 |
| Compound Structure |  |
| Plant Source | Lippia origanoides Common Name:Wild Marjoram |
| Source Family | Verbenaceae |
| Origin | USA |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (4.4 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 160 ± 72 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Thujene |
| PubChem ID | 12444322 |
| Ethnomedicinal Information | Treatment of influenza, colds and pulmonary infections |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C12([C@@H](C1)C(=CC2)C)C(C)C |
| XLogP | 4.177 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sáhez JG, Martíz-Morales JR, Stashenko EE, Ribó. Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia. Biomedica. 2009 Mar;29(1):51-60
2) Santos, Francisco J B dos, Lopes, J Arimatia D, Cito, A M Graas L, de Oliveira, Evaldo H, Et al Composition and Biological Activity of Essential oils from Lippia origanoides H.B.K. Journal of Essential oil Research: JEOR, Sep/Oct 2004
|
| Curator | |
