| Compound ID | 1533 |
| Compound Structure |  |
| Plant Source | Coptis coinensia French Common Name: |
| Source Family | Ranunculaceae |
| Origin | China |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | 1:800 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Berberine bisulphate |
| PubChem ID | 12457 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 14778141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Isoquinoline, Sulphate |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 336.124 |
| Molecular Formula | C20H19NO8S |
| SMILES | S(=O)(=O)(O)[O-].O1c2cc3CC[n+]4c(c3cc2OC1)cc1c(c4)c(OC)c(OC)cc1 |
| XLogP | 2.896 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Wang VF.In vitro antibacterial activity of some common Chinese herbs on Mycobacteria tuberculosis.Chin Med J. 1950 May-Jun;68(5-6):169-72
|
| Curator | |
