| Compound ID | 3809 |
| Compound Structure |  |
| Plant Source | Angelica sinensis Common Name:Dang Gui |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Northwest China |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 60 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 8 - Hydroxy - 1 - Methoxy - (Z) - 9 - Heptadecene 4, 6 - Diyn - 3 - One |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18567055 |
| Extract Preparation | 8 kg of the pulverized roots of Angelica sinensis Diels were extracted with methanol and the extract sequentially partitioned with petroleum ether, CHCl3, and BuOH |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Ketone, Ether, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 290.188 |
| Molecular Formula | C18H26O3 |
| SMILES | COCCC(=O)C#CC#CC(/C=CCCCCCCC)O |
| XLogP | 4.421 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Deng S, Wang Y, Inui T, Chen SN, Farnsworth NR, Cho S, Franzblau SG, Pauli GF.Anti-TB polyynes from the roots of Angelica sinensis.Phytother Res. 2008 Jul;22(7):878-82
|
| Curator | KeyaMukherjee, reshmi, Farzana Shamsudeen, Vikramjitmandal |
| Compound ID | 3814 |
| Compound Structure | |
| Plant Source | Angelica sinensis Common Name:Dang Gui |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Northwest China |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis (Erdman) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.05 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 60 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 8 - Hydroxy - 1 - Methoxy - (Z) - 9 - Heptadecene 4, 6 - Diyn - 3 - One |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18567055 |
| Extract Preparation | 8 kg of the pulverized roots of Angelica sinensis Diels were extracted with methanol and the extract sequentially partitioned with petroleum ether, CHCl3, and BuOH |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Ketone, Ether, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 290.188 |
| Molecular Formula | C18H26O3 |
| SMILES | COCCC(=O)C#CC#CC(/C=CCCCCCCC)O |
| XLogP | 4.421 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Deng S, Wang Y, Inui T, Chen SN, Farnsworth NR, Cho S, Franzblau SG, Pauli GF.Anti-TB polyynes from the roots of Angelica sinensis.Phytother Res. 2008 Jul;22(7):878-82
|
| Curator | KeyaMukherjee, reshmi, Farzana Shamsudeen, Vikramjitmandal |
