| Compound ID | 3759 |
| Compound Structure |  |
| Plant Source | Artcarpus rigidus BLUME subsp. rigidus Common Name:NR |
| Source Family | Moraceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Artonin F |
| PubChem ID | 14680593 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17015984 |
| Extract Preparation | The dried root bark (1.5 kg) was milled and extracted successively with n - hexane, CHCl3 and MeOH in a Soxhlet extraction apparatus. The extracts were evaporated to dryness under reduced pressure at about 40°C. The hexane extract (brownish syrup, 8.4 g), the CHCl3 extract (dark brownish sticky solid, 16.1 g) and the methanolic extract (dark brownish mass, 45.6 g) were obtained, respectively |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Flavonoid, Benzopyran, Benzofuranoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against human epidermoid carcinoma in the mouth (KB), human breast cancer cells (BC), human lung cancer cells (NCI - H187) |
| Molecular Weight | 502.199 |
| Molecular Formula | C30H30O7 |
| SMILES | O1C(C2c3c1c(O)cc(O)c3c1oc3c(c(=O)c1C2)c(O)c(c1OC(C=Cc31)(C)C)CC=C(C)C)(C)C |
| XLogP | 3.394 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Namdaung U, Aroonrerk N, Suksamrarn S, Danwisetkanjana K, Saenboonrueng J, Arjchomphu W, Suksamrarn A.Bioactive constituents of the root bark of Artocarpus rigidus subsp. rigidus.Chem Pharm Bull (Tokyo). 2006 Oct;54(10):1433-6
|
| Curator | Reshmi, vikramjitmandal, rachanake |
