| Compound ID | 3797 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (0.25 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 8 - Hydroxy Canthin - 6 - One |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 235.063 |
| Molecular Formula | C15H9NO2 |
| SMILES | C1ccc(c2c1c1c3n2c(=O)ccc3ccc1)O |
| XLogP | 2.854 |
| PSA | 42.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
