| Compound ID | 3560 |
| Compound Structure |  |
| Plant Source | Sapium indicum L. Common Name:Huma (English) |
| Source Family | Euphorbiaceae |
| Origin | India |
| Plant Part Used | Fruit |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 - 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sapintoxin B |
| PubChem ID | 157762 |
| Ethnomedicinal Information | Purgative, insanity, poisonous in nature, intoxicating fish |
| PubMed ID [Source Literature] | 12713411 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Diterpene, Benzoyl, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 539.252 |
| Molecular Formula | C30H37NO8 |
| SMILES | O([C@@]12[C@@H](C1(C)C)[C@H]1[C@](O)([C@@H]([C@H]2OC(=O)c2c(NC)cccc2)C)[C@H]2[C@H]([C@H](O)C(=C1)CO)C(=O)C(=C2)C)C(=O)C |
| XLogP | 2.295 |
| PSA | 142.390 |
| H-bond Donor | 4 |
| H-bond Acceptor | 9 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) Chumkaew P, Karalai C, Ponglimanont C, Chantrapromma K.Antimycobacterial activity of phorbol esters from the fruits of Sapium indicum.J Nat Prod. 2003 Apr;66(4):540-3
|
| Curator | Rachana, vikramjitmandal |
