| Compound ID | 1685 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (2.93 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4.72 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Neodiospyrin |
| PubChem ID | 16072922 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Nathalene, Napthoquinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 374.079 |
| Molecular Formula | C22H14O6 |
| SMILES | Oc1c2c(c(C3=CC(=O)c4c(C3=O)c(O)cc(c4)C)c(c1)C)C(=O)C=CC2=O |
| XLogP | 1.294 |
| PSA | 108.740 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1689 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (1.95 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 93.75 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Neodiospyrin |
| PubChem ID | 16072922 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Nathalene, Napthoquinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 374.079 |
| Molecular Formula | C22H14O6 |
| SMILES | Oc1c2c(c(C3=CC(=O)c4c(C3=O)c(O)cc(c4)C)c(c1)C)C(=O)C=CC2=O |
| XLogP | 1.294 |
| PSA | 108.740 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1693 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (3.26 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 98.96 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Neodiospyrin |
| PubChem ID | 16072922 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Nathalene, Napthoquinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 374.079 |
| Molecular Formula | C22H14O6 |
| SMILES | Oc1c2c(c(C3=CC(=O)c4c(C3=O)c(O)cc(c4)C)c(c1)C)C(=O)C=CC2=O |
| XLogP | 1.294 |
| PSA | 108.740 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1697 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium bovis ATCC |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (1.49 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 17.58 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Neodiospyrin |
| PubChem ID | 16072922 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Nathalene, Napthoquinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 374.079 |
| Molecular Formula | C22H14O6 |
| SMILES | Oc1c2c(c(C3=CC(=O)c4c(C3=O)c(O)cc(c4)C)c(c1)C)C(=O)C=CC2=O |
| XLogP | 1.294 |
| PSA | 108.740 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1701 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (0.062 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Neodiospyrin |
| PubChem ID | 16072922 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Nathalene, Napthoquinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 374.079 |
| Molecular Formula | C22H14O6 |
| SMILES | Oc1c2c(c(C3=CC(=O)c4c(C3=O)c(O)cc(c4)C)c(c1)C)C(=O)C=CC2=O |
| XLogP | 1.294 |
| PSA | 108.740 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |