| Compound ID | 3742 |
| Compound Structure |  |
| Plant Source | Swartzia polyphylla DC Common Name:Cumaseba |
| Source Family | Fabaceae |
| Origin | Peru |
| Plant Part Used | Bark |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | T-cadinol |
| PubChem ID | 160799 |
| Ethnomedicinal Information | Larvicidal, antifungal, aphrodisiac, antiseptic, tonic, bad eyesight, bone fractures, childbirth, colds, dislocations, fatigue, fungal infections, laziness, optic nerve injuries, rheumatism, and yeast infections. It also inhibits the in vitro growth of the dermatophyte Trichophyton mentagrophytes, and was active against the larvae of the mosquito Culex quinquefasciatus |
| PubMed ID [Source Literature] | 16462085 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O |
| SMILES | O[C@@]1([C@H]2[C@H]([C@@H](CC1)C(C)C)C=C(CC2)C)C |
| XLogP | 4.476 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Rojas R, Bustamante B, Ventosilla P, Fernádez I, Caviedes L, Gilman RH, Lock O, Hammond GB.Larvicidal, antimycobacterial and antifungal compounds from the bark of the Peruvian plant Swartzia polyphylla DC.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):278-9
|
| Curator | Vikramjitmandal |
| Compound ID | 3743 |
| Compound Structure | |
| Plant Source | Swartzia polyphylla DC Common Name:Cumaseba |
| Source Family | Fabaceae |
| Origin | Peru |
| Plant Part Used | Bark |
| Extract | Ethanol (95 %) |
| Target Bacteria | Multi - drug resistant Mycobacterium tuberculosis strain (Clinical isolate, strain 02 tuberculosis DM039EP097) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | T-cadinol |
| PubChem ID | 160799 |
| Ethnomedicinal Information | Larvicidal, antifungal, aphrodisiac, antiseptic, tonic, bad eyesight, bone fractures, childbirth, colds, dislocations, fatigue, fungal infections, laziness, optic nerve injuries, rheumatism, and yeast infections. It also inhibits the in vitro growth of the dermatophyte Trichophyton mentagrophytes, and was active against the larvae of the mosquito Culex quinquefasciatus |
| PubMed ID [Source Literature] | 16462085 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O |
| SMILES | O[C@@]1([C@H]2[C@H]([C@@H](CC1)C(C)C)C=C(CC2)C)C |
| XLogP | 4.476 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Rojas R, Bustamante B, Ventosilla P, Fernádez I, Caviedes L, Gilman RH, Lock O, Hammond GB.Larvicidal, antimycobacterial and antifungal compounds from the bark of the Peruvian plant Swartzia polyphylla DC.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):278-9
|
| Curator | Vikramjitmandal |
