| Compound ID | 3627 |
| Compound Structure |  |
| Plant Source | Piper sanctum (Miq.) Schl. Common Name: |
| Source Family | Piperaceae |
| Origin | Southcentral region of Mexico |
| Plant Part Used | Leaf |
| Extract | Dichloromethane:Methanol (1:1) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cepharanone B |
| PubChem ID | 162739 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620234 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Phenanthrene, Amide, Ether, |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 279.090 |
| Molecular Formula | C17H13NO3 |
| SMILES | O(c1c2c3c([nH]c(=O)c3cc1OC)cc1c2cccc1)C |
| XLogP | 3.379 |
| PSA | 47.560 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Mata R, Morales I, Pérez O, Rivero-Cruz I, Acevedo L, Enriquez-Mendoza I, Bye R, Franzblau S, Timmermann B.Antimycobacterial compounds from Piper sanctum.J Nat Prod. 2004 Dec;67(12):1961-8
|
| Curator | Rachana, Keyamukherjee, vikramjitmandal |