| Compound ID | 3942 |
| Compound Structure |  |
| Plant Source | Butea monosperma (LAM.) TAUB. Common Name:Flame of the Forest |
| Source Family | Fabaceae |
| Origin | Tropical Southern Asia, Pakistan, India, Bangladesh |
| Plant Part Used | Flower |
| Extract | EtOAc and MeOH |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin Sulphate (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (-)- Butrin |
| PubChem ID | 164630 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19336944 |
| Extract Preparation | The dried flowers (15.0 kg) were milled and soaked successively with n - hexane, EtOAc and MeOH. The hexane, EtOAc and MeOH extracts were evaporated under reduced pressure to give the crude hexane extract (brownish syrup, 32.8 g), the EtOAc extract (dark brownish sticky solid, 102.7 g) and the MeOH extract (dark brownish sticky solid, 527.6 g) |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 596.174 |
| Molecular Formula | C27H32O15 |
| SMILES | O1[C@@H]([C@@H](O)[C@H](O)[C@@H](O)[C@@H]1Oc1cc([C@H]2Oc3c(C(=O)C2)ccc(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)CO)c3)ccc1O)CO |
| XLogP | -1.319 |
| PSA | 245.290 |
| H-bond Donor | 9 |
| H-bond Acceptor | 15 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 15 |
| No. of S | 0 |
| Reference(s) | 1) Chokchaisiri R, Suaisom C, Sriphota S, Chindaduang A, Chuprajob T, Suksamrarn A.Bioactive flavonoids of the flowers of Butea monosperma.Chem Pharm Bull (Tokyo). 2009 Apr;57(4):428-32
|
| Curator | Vikramjitmandal, Keyamukherjee, najiya-beegum, swatigandhi |
