| Compound ID | 3955 |
| Compound Structure |  |
| Plant Source | Inula helenium L. Common Name:Elecampane |
| Source Family | Asteraceae (Compositae) |
| Origin | India, USA |
| Plant Part Used | Root |
| Extract | Hexane, dichloromethane, methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 11α H, 13 - Dihydroisoalantolactone |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2 |
| SMILES | C1CCC(=C)[C@H]2[C@]1(C[C@H]1OC(=O)C(=C)[C@H]1C2)C |
| XLogP | 3.681 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1.4. Lalit Mohan Basu, Allahabad, India
|
| Curator | Vikramjitmandal |
