| Compound ID | 3057 |
| Compound Structure |  |
| Plant Source | Ajuga remota Benth. Common Name:NR |
| Source Family | Lamiaceae |
| Origin | NR |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ajugarin - I |
| PubChem ID | 173866 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10630115 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Acetyl, Lactone, Epoxide |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 434.230 |
| Molecular Formula | C24H34O7
|
| SMILES | O1[C@]2([C@]3([C@@H]([C@]([C@@H](C[C@@H]3OC(=O)C)C)(CCC3=CC(=O)OC3)C)CCC2)COC(=O)C)C1 |
| XLogP | 3.862 |
| PSA | 91.430 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Rajab MS, Franzblau SG, Fronczek FR, Fischer NH.Antimycobacterial ergosterol-5,8-endoperoxide from Ajuga remota.Planta Med. 1999 Dec;65(8):732-4
|
| Curator | |
