| Compound ID | 2030 |
| Compound Structure |  |
| Plant Source | Leucas volkensii Gurke Common Name: |
| Source Family | Labiatae |
| Origin | Kenya |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (3R,S7R,11R)-Phytanol |
| PubChem ID | 192019 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 9491760 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Terpene, Diterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 298.324 |
| Molecular Formula | C20H42O
|
| SMILES | OCC(CCCC(CCCC(CCCC(CC)C)C)C)C |
| XLogP | 9.500 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Rajab MS, Cantrell CL, Franzblau SG, Fischer NH.Antimycobacterial activity of (E)-phytol and derivatives: a preliminary structure-activity study.Planta Med. 1998 Feb;64(1):2-4
|
| Curator | |
