| Compound ID | 1056 |
| Compound Structure |  |
| Plant Source | Adhatoda vasica Nees Common Name:Malabar Nut Tree (English), Vasaka (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bromhexine |
| PubChem ID | 2442 |
| Ethnomedicinal Information | Treatment of tuberculosis, asthma and also as expectorants, bronchial disorders such as acute and chronic cough, bronchitis |
| PubMed ID [Source Literature] | 8778507 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Cyclohexane, Amine, Haloginated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 373.999 |
| Molecular Formula | C14H20Br2N2
|
| SMILES | Brc1c(N)c(CN(C2CCCCC2)C)cc(Br)c1 |
| XLogP | 4.004 |
| PSA | 29.260 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Grange JM, Snell NJ.Activity of bromhexine and ambroxol, semi-synthetic derivatives of vasicine from the Indian shrub Adhatoda vasica, against Mycobacterium tuberculosis in vitro.J Ethnopharmacol. 1996 Jan;50(1):49-53
|
| Curator | |
