| Compound ID | 1441 |
| Compound Structure |  |
| Plant Source | Chromolaena odorata Common Name:Siam Weed, Christmas Bush, Common Floss Flower |
| Source Family | Asteraceae (Compositae) |
| Origin | Neotropics, Worldwide |
| Plant Part Used | Flower |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin sulphate (2.50 µg/ml), Isoniazid (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 4` - Hydroxy - 5, 6, 7 - Trimethoxyflavanone |
| PubChem ID | 244387 |
| Ethnomedicinal Information | Treats skin wounds |
| PubMed ID [Source Literature] | 15202555, 10811796 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 330.110 |
| Molecular Formula | C18H18O6 |
| SMILES | O1C(CC(=O)c2c1cc(OC)c(OC)c2OC)c1ccc(O)cc1 |
| XLogP | 1.491 |
| PSA | 74.220 |
| H-bond Donor | 1 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn, A., Chotipong, A., Suavansri, T., Boongird, S., Timsuksai, P., Vimuttipong, S., et al. (2004). Antimycobacterial activity and cytotoxicity of flavonoids from the flowers of Chromolaena odorata. Arch Pharm Res 27, 507u511
2) Schmidt GJ, Schilling EE.Phylogeny and biogeography of Eupatorium (Asteraceae: Eupatorieae) based on nuclear ITS sequence data.Am J Bot. 2000 May;87(5):716-26
|
| Curator | |
