| Compound ID | 2825 |
| Compound Structure |  |
| Plant Source | Zanthoxylum wutaiense Common Name: |
| Source Family | Rutaceae |
| Origin | China |
| Plant Part Used | Root, wood |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 35 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 7 - Methoxywutaifuranal |
| PubChem ID | 24970511 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 18564877 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Aldehyde, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 202.063 |
| Molecular Formula | C12H10O3
|
| SMILES | O1c2c(cc(cc2OC)/C=C/C=O)cc1 |
| XLogP | 1.914 |
| PSA | 39.440 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Huang HY, Ishikawa T, Peng CF, Tsai IL, Chen IS.Constituents of the root wood of Zanthoxylum wutaiense with antitubercular activity.J Nat Prod. 2008 Jul;71(7):1146-51
|
| Curator | |
