| Compound ID | 4118 |
| Compound Structure |  |
| Plant Source | Ipomoea tyrianthina Common Name: |
| Source Family | Convolvulaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv ATCC 27296 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC240 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid, Acyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 1072.567 |
| Molecular Formula | C50H88O24 |
| SMILES | O[C@H]1[C@H](O)[C@@H](O[C@H]2[C@H](O[C@H]3[C@H](OC(=O)C(CC)C)[C@H](O)[C@@H](O[C@H]4[C@H](O)[C@@H](O)[C@H](OC(=O)C(C)C(O)C)[C@@H](C)O4)[C@H](C)O3)[C@@H](O)[C@H](O)[C@@H](CO)O2)[C@H](O[C@@](CCCCC)(O)CCCCCCCCCC(=O)O)O[C@@H]1C |
| XLogP | 2.908 |
| PSA | 366.040 |
| H-bond Donor | 11 |
| H-bond Acceptor | 24 |
| No. of Rotatable Bond Count | 31 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 24 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
