| Compound ID | 1218 |
| Compound Structure |  |
| Plant Source | Artocarpus lakoocha Roxb.Artocarpus lacucha Buch.-Ham Common Name:Monkey Jack (English), Lakuch, Kshudra Panas, Granthiphala, Pitanaasha (Sanskrit) |
| Source Family | Moraceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml) and Kanamycin sulphate (2 – 5 µg/ml)) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Lakoochin A |
| PubChem ID | 3012524 |
| Ethnomedicinal Information | Leprosy, used as folkmedicine for other diseases |
| PubMed ID [Source Literature] | 15043440 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Stilbene, Furanoid, Phenol, Prenylated, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 406.214 |
| Molecular Formula | C26H30O4 |
| SMILES | O1c(c2c(CC=C(C)C)c(OC)cc(OC)c2CC=C(C)C)cc2c1cc(O)cc2 |
| XLogP | 5.873 |
| PSA | 51.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Puntumchai A, Kittakoop P, Rajviroongit S, Vimuttipong S, Likhitwitayawuid K, Thebtaranonth Y.Lakoochins A and B, new antimycobacterial stilbene derivatives from Artocarpus lakoocha.J Nat Prod. 2004 Mar;67(3):485-6
2) Pushpangadan P, Atal CK.Ethno-medico-botanical investigations in Kerala I. Some primitive tribals of western ghats and their herbal medicine.J Ethnopharmacol. 1984 Jun;11(1):59-77
|
| Curator | |
