| Compound ID | 3914 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3915 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3916 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (32 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3917 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Not Tested |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Not tested |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3918 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3919 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |