| Compound ID | 3071 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Micheliolide |
| PubChem ID | 442279 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3 |
| SMILES | O1[C@@H]2[C@H]3[C@](O)(CCC3=C(CC[C@H]2C(=C)C1=O)C)C |
| XLogP | 1.233 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
