| Compound ID | 1786 |
| Compound Structure |  |
| Plant Source | Galipea officinalis Common Name:Angustura Vera |
| Source Family | Rutaceae |
| Origin | South America |
| Plant Part Used | Bark |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Isoniazid (0.12 µg/ml), Rifampin (0.001 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cusparine |
| PubChem ID | 442893 |
| Ethnomedicinal Information | Used to treat diarrhoea and fevers |
| PubMed ID [Source Literature] | 10232071 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkaloid, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 307.121 |
| Molecular Formula | C19H17NO3
|
| SMILES | O1c2cc(CCc3nc4c(c(OC)c3)cccc4)ccc2OC1 |
| XLogP | 4.688 |
| PSA | 40.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 4 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Houghton PJ, Woldemariam TZ, Watanabe Y, Yates M.Activity against Mycobacterium tuberculosis of alkaloid constituents of Angostura bark, Galipea officinalis.Planta Med. 1999 Apr;65(3):250-4
|
| Curator | |
