| Compound ID | 3611 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (1 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleic acid |
| PubChem ID | 445639 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 282.256 |
| Molecular Formula | C18H34O2 |
| SMILES | OC(=O)CCCCCCC/C=CCCCCCCCC |
| XLogP | 8.192 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3612 |
| Compound Structure | |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleic acid |
| PubChem ID | 445639 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 282.256 |
| Molecular Formula | C18H34O2 |
| SMILES | OC(=O)CCCCCCC/C=CCCCCCCCC |
| XLogP | 8.192 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
